C11H13FS2Si — CID 140824385
[5-(3-fluorothiophen-2-yl)thiophen-2-yl]-trimethylsilane (PubChem CID 140824385) has the molecular formula C11H13FS2Si and a molecular weight of 256.44 g/mol. Its IUPAC name is [5-(3-fluorothiophen-2-yl)thiophen-2-yl]-trimethylsilane.
| Compound Name | [5-(3-fluorothiophen-2-yl)thiophen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 140824385 |
| Molecular Formula | C11H13FS2Si |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | [5-(3-fluorothiophen-2-yl)thiophen-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2sccc2F)s1 |
| InChI | InChI=1S/C11H13FS2Si/c1-15(2,3)10-5-4-9(14-10)11-8(12)6-7-13-11/h4-7H,1-3H3 |
| InChIKey | NIRZTLZBIBYAEY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|