About 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride
3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride (PubChem CID 140824403) has the molecular formula C9H20Cl2N2O3
and a molecular weight of 275.18 g/mol. Its IUPAC name is 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride |
| PubChem CID | 140824403 |
| Molecular Formula | C9H20Cl2N2O3 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride |
| SMILES | COC[C@@H]1CNCCN1CCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C9H18N2O3.2ClH/c1-14-7-8-6-10-3-5-11(8)4-2-9(12)13;;/h8,10H,2-7H2,1H3,(H,12,13);2*1H/t8-;;/m0../s1 |
| InChIKey | MKDMTJLISJIMAO-JZGIKJSDSA-N |
| XLogP | 0.22 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride?
The IUPAC name of 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride (CID 140824403) is 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride.
What is the SMILES notation for 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride?
The canonical SMILES for 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride is COC[C@@H]1CNCCN1CCC(=O)O.Cl.Cl.
What is the InChIKey of 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride?
The InChIKey is MKDMTJLISJIMAO-JZGIKJSDSA-N. The full InChI is InChI=1S/C9H18N2O3.2ClH/c1-14-7-8-6-10-3-5-11(8)4-2-9(12)13;;/h8,10H,2-7H2,1H3,(H,12,13);2*1H/t8-;;/m0../s1.
What are the key properties of 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride?
3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride has a molecular weight of 275.18 g/mol, XLogP of 0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2-(methoxymethyl)piperazin-1-yl]propanoic acid;dihydrochloride is sourced from PubChem (CID 140824403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).