C24H33N3OSi — CID 140824527
[(1R,2R,4S)-4-azido-2-ethylcyclohexyl]oxy-tert-butyl-diphenylsilane (PubChem CID 140824527) has the molecular formula C24H33N3OSi and a molecular weight of 407.63 g/mol. Its IUPAC name is [(1R,2R,4S)-4-azido-2-ethylcyclohexyl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,2R,4S)-4-azido-2-ethylcyclohexyl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 140824527 |
| Molecular Formula | C24H33N3OSi |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | [(1R,2R,4S)-4-azido-2-ethylcyclohexyl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC[C@@H]1C[C@@H](N=[N+]=[N-])CC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H33N3OSi/c1-5-19-18-20(26-27-25)16-17-23(19)28-29(24(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,23H,5,16-18H2,1-4H3/t19-,20+,23-/m1/s1 |
| InChIKey | BZXWXBWRIQEHAG-ZRCGQRJVSA-N |
| XLogP | 5.82 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|