C24H26F3N7O4 — CID 140824691
8-N-[4-[[(3S)-oxolan-3-yl]carbamoyl]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824691) has the molecular formula C24H26F3N7O4 and a molecular weight of 533.51 g/mol. Its IUPAC name is 8-N-[4-[[(3S)-oxolan-3-yl]carbamoyl]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-[[(3S)-oxolan-3-yl]carbamoyl]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824691 |
| Molecular Formula | C24H26F3N7O4 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 8-N-[4-[[(3S)-oxolan-3-yl]carbamoyl]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(C(=O)N[C@H]3CCOC3)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C24H26F3N7O4/c1-13(24(25,26)27)29-22(36)17-2-3-18-20(31-17)34(16-5-8-33(18)11-16)23(37)32-19-10-14(4-7-28-19)21(35)30-15-6-9-38-12-15/h2-4,7,10,13,15-16H,5-6,8-9,11-12H2,1H3,(H,29,36)(H,30,35)(H,28,32,37)/t13-,15+,16?/m1/s1 |
| InChIKey | WSJCQOZFFIKMKD-YISXUXMPSA-N |
| XLogP | 2.31 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |