C20H19F3N10O2 — CID 140824717
8-N-[4-(2H-tetrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824717) has the molecular formula C20H19F3N10O2 and a molecular weight of 488.43 g/mol. Its IUPAC name is 8-N-[4-(2H-tetrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2H-tetrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824717 |
| Molecular Formula | C20H19F3N10O2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 8-N-[4-(2H-tetrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(-c3nn[nH]n3)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N10O2/c1-10(20(21,22)23)25-18(34)13-2-3-14-17(26-13)33(12-5-7-32(14)9-12)19(35)27-15-8-11(4-6-24-15)16-28-30-31-29-16/h2-4,6,8,10,12H,5,7,9H2,1H3,(H,25,34)(H,24,27,35)(H,28,29,30,31)/t10-,12?/m1/s1 |
| InChIKey | KQNAIEICLNTFNT-RWANSRKNSA-N |
| XLogP | 1.97 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |