C21H23F3N6O4 — CID 140824824
8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824824) has the molecular formula C21H23F3N6O4 and a molecular weight of 480.45 g/mol. Its IUPAC name is 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824824 |
| Molecular Formula | C21H23F3N6O4 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(OCCO)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N6O4/c1-12(21(22,23)24)26-19(32)15-2-3-16-18(27-15)30(13-5-7-29(16)11-13)20(33)28-17-10-14(4-6-25-17)34-9-8-31/h2-4,6,10,12-13,31H,5,7-9,11H2,1H3,(H,26,32)(H,25,28,33)/t12-,13?/m1/s1 |
| InChIKey | JSZDDGLHUSJASF-PZORYLMUSA-N |
| XLogP | 2.16 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |