C18H34 — CID 140825138
1,5,5-trimethyl-4-(3,4,5,5-tetramethylhexyl)cyclopentene (PubChem CID 140825138) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 1,5,5-trimethyl-4-(3,4,5,5-tetramethylhexyl)cyclopentene.
| Compound Name | 1,5,5-trimethyl-4-(3,4,5,5-tetramethylhexyl)cyclopentene |
|---|---|
| PubChem CID | 140825138 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 1,5,5-trimethyl-4-(3,4,5,5-tetramethylhexyl)cyclopentene |
| SMILES | CC1=CCC(CCC(C)C(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C18H34/c1-13(15(3)17(4,5)6)9-11-16-12-10-14(2)18(16,7)8/h10,13,15-16H,9,11-12H2,1-8H3 |
| InChIKey | ZYOMSBLTKHDVAR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|