About diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium
diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium (PubChem CID 140825239) has the molecular formula C14H10F3O2S+
and a molecular weight of 299.29 g/mol. Its IUPAC name is diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium.
Molecular Properties
| Compound Name | diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium |
| PubChem CID | 140825239 |
| Molecular Formula | C14H10F3O2S+ |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium |
| SMILES | O=C(O[S+](c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H10F3O2S/c15-14(16,17)13(18)19-20(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/q+1 |
| InChIKey | ABCHZOQFOWNRLP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium?
The IUPAC name of diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium (CID 140825239) is diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium.
What is the SMILES notation for diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium?
The canonical SMILES for diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium is O=C(O[S+](c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium?
The InChIKey is ABCHZOQFOWNRLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3O2S/c15-14(16,17)13(18)19-20(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/q+1.
What are the key properties of diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium?
diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium has a molecular weight of 299.29 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-(2,2,2-trifluoroacetyl)oxysulfanium is sourced from PubChem (CID 140825239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).