C34H15F4N5O — CID 140825448
20-[3-(2,4-difluoro-3-isocyanophenyl)-5-(2,6-difluoro-3-pyridinyl)phenyl]-9-oxa-2,11,19-triazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17,19-nonaene (PubChem CID 140825448) has the molecular formula C34H15F4N5O and a molecular weight of 585.52 g/mol. Its IUPAC name is 20-[3-(2,4-difluoro-3-isocyanophenyl)-5-(2,6-difluoro-3-pyridinyl)phenyl]-9-oxa-2,11,19-triazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17,19-nonaene.
| Compound Name | 20-[3-(2,4-difluoro-3-isocyanophenyl)-5-(2,6-difluoro-3-pyridinyl)phenyl]-9-oxa-2,11,19-triazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 140825448 |
| Molecular Formula | C34H15F4N5O |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | 20-[3-(2,4-difluoro-3-isocyanophenyl)-5-(2,6-difluoro-3-pyridinyl)phenyl]-9-oxa-2,11,19-triazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17,19-nonaene |
| SMILES | [C-]#[N+]c1c(F)ccc(-c2cc(-c3ccc(F)nc3F)cc(-c3nc4ccccc4c4nc5oc6ccccc6n5c34)c2)c1F |
| InChI | InChI=1S/C34H15F4N5O/c1-39-31-23(35)12-10-20(28(31)37)17-14-18(21-11-13-27(36)41-33(21)38)16-19(15-17)29-32-30(22-6-2-3-7-24(22)40-29)42-34-43(32)25-8-4-5-9-26(25)44-34/h2-16H |
| InChIKey | QJVTXRKJAGJSJQ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 60.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|