C30H29N — CID 140825856
4-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-2-(2-methylphenyl)pyridine (PubChem CID 140825856) has the molecular formula C30H29N and a molecular weight of 404.58 g/mol. Its IUPAC name is 4-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-2-(2-methylphenyl)pyridine.
| Compound Name | 4-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-2-(2-methylphenyl)pyridine |
|---|---|
| PubChem CID | 140825856 |
| Molecular Formula | C30H29N |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-2-(2-methylphenyl)pyridine |
| SMILES | [2H]C1(c2ccc(-c3ccc(-c4ccnc(-c5ccccc5C)c4)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C30H29N/c1-22-7-5-6-10-29(22)30-21-28(19-20-31-30)27-17-15-26(16-18-27)25-13-11-24(12-14-25)23-8-3-2-4-9-23/h5-7,10-21,23H,2-4,8-9H2,1H3/i23D |
| InChIKey | CXUARDQJIXIPJJ-WBQFYUNPSA-N |
| XLogP | 8.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |