C44H26N6Se — CID 140826207
4,12-bis(9-phenylcarbazol-3-yl)-8-selena-3,5,6,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 140826207) has the molecular formula C44H26N6Se and a molecular weight of 717.69 g/mol. Its IUPAC name is 4,12-bis(9-phenylcarbazol-3-yl)-8-selena-3,5,6,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 4,12-bis(9-phenylcarbazol-3-yl)-8-selena-3,5,6,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 140826207 |
| Molecular Formula | C44H26N6Se |
| Molecular Weight | 717.69 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 4,12-bis(9-phenylcarbazol-3-yl)-8-selena-3,5,6,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | c1ccc(-n2c3ccccc3c3cc(-c4cc5c(cn4)[se]c4nnc(-c6ccc7c(c6)c6ccccc6n7-c6ccccc6)nc45)ccc32)cc1 |
| InChI | InChI=1S/C44H26N6Se/c1-3-11-29(12-4-1)49-37-17-9-7-15-31(37)33-23-27(19-21-39(33)49)36-25-35-41(26-45-36)51-44-42(35)46-43(47-48-44)28-20-22-40-34(24-28)32-16-8-10-18-38(32)50(40)30-13-5-2-6-14-30/h1-26H |
| InChIKey | PWXASLDURAOGBM-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.69 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|