About CID 140826560
CID 140826560 (PubChem CID 140826560) has the molecular formula C41H25F3IrN5O-
and a molecular weight of 852.90 g/mol.
Molecular Properties
| Compound Name | CID 140826560 |
| PubChem CID | 140826560 |
| Molecular Formula | C41H25F3IrN5O- |
| Molecular Weight | 852.90 g/mol |
| Exact Mass | 853.16 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc2c(-c3[c-]cc4c(c3)C3CCC4C3)ncc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4ccccc45)n3)c2n1.[Ir] |
| InChI | InChI=1S/C41H25F3N5O.Ir/c42-41(43,44)34-18-17-29-35(25-15-16-26-23-13-14-24(19-23)31(26)20-25)45-21-32(36(29)46-34)40-48-38(22-7-2-1-3-8-22)47-39(49-40)30-11-6-10-28-27-9-4-5-12-33(27)50-37(28)30;/h1-12,16-18,20-21,23-24H,13-14,19H2;/q-1; |
| InChIKey | XESDIRRJFZNTGI-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 852.90 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140826560 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140826560?
The IUPAC name of CID 140826560 (CID 140826560) is not available.
What is the SMILES notation for CID 140826560?
The canonical SMILES for CID 140826560 is FC(F)(F)c1ccc2c(-c3[c-]cc4c(c3)C3CCC4C3)ncc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4ccccc45)n3)c2n1.[Ir].
What is the InChIKey of CID 140826560?
The InChIKey is XESDIRRJFZNTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H25F3N5O.Ir/c42-41(43,44)34-18-17-29-35(25-15-16-26-23-13-14-24(19-23)31(26)20-25)45-21-32(36(29)46-34)40-48-38(22-7-2-1-3-8-22)47-39(49-40)30-11-6-10-28-27-9-4-5-12-33(27)50-37(28)30;/h1-12,16-18,20-21,23-24H,13-14,19H2;/q-1;.
What are the key properties of CID 140826560?
CID 140826560 has a molecular weight of 852.90 g/mol, XLogP of 10.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140826560 is sourced from PubChem (CID 140826560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).