C45H35F3IrN5O- — CID 140826668
8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine;iridium (PubChem CID 140826668) has the molecular formula C45H35F3IrN5O- and a molecular weight of 911.02 g/mol. Its IUPAC name is 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine;iridium.
| Compound Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine;iridium |
|---|---|
| PubChem CID | 140826668 |
| Molecular Formula | C45H35F3IrN5O- |
| Molecular Weight | 911.02 g/mol |
| Exact Mass | 911.24 |
| IUPAC Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine;iridium |
| SMILES | CC1(C)c2c[c-]c(-c3ncc(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)c4nc(C(F)(F)F)ccc34)cc2C(C)(C)C1(C)C.[Ir] |
| InChI | InChI=1S/C45H35F3N5O.Ir/c1-42(2)32-21-19-26(23-33(32)43(3,4)44(42,5)6)36-29-20-22-35(45(46,47)48)50-37(29)31(24-49-36)41-52-39(25-13-8-7-9-14-25)51-40(53-41)30-17-12-16-28-27-15-10-11-18-34(27)54-38(28)30;/h7-18,20-24H,1-6H3;/q-1; |
| InChIKey | XVYFHBJWYJDBGP-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.02 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|