C48H49F2IrN4- — CID 140826706
2,4-bis(4-tert-butylphenyl)-6-[4-[6-(2,2-difluoro-1,1,3,3-tetramethyl-6H-inden-6-id-5-yl)-4-methyl-3-pyridinyl]phenyl]-1,3,5-triazine;iridium (PubChem CID 140826706) has the molecular formula C48H49F2IrN4- and a molecular weight of 912.16 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[4-[6-(2,2-difluoro-1,1,3,3-tetramethyl-6H-inden-6-id-5-yl)-4-methyl-3-pyridinyl]phenyl]-1,3,5-triazine;iridium.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[6-(2,2-difluoro-1,1,3,3-tetramethyl-6H-inden-6-id-5-yl)-4-methyl-3-pyridinyl]phenyl]-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 140826706 |
| Molecular Formula | C48H49F2IrN4- |
| Molecular Weight | 912.16 g/mol |
| Exact Mass | 912.36 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[6-(2,2-difluoro-1,1,3,3-tetramethyl-6H-inden-6-id-5-yl)-4-methyl-3-pyridinyl]phenyl]-1,3,5-triazine;iridium |
| SMILES | Cc1cc(-c2[c-]cc3c(c2)C(C)(C)C(F)(F)C3(C)C)ncc1-c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1.[Ir] |
| InChI | InChI=1S/C48H49F2N4.Ir/c1-29-26-40(34-20-25-38-39(27-34)47(10,11)48(49,50)46(38,8)9)51-28-37(29)30-12-14-31(15-13-30)41-52-42(32-16-21-35(22-17-32)44(2,3)4)54-43(53-41)33-18-23-36(24-19-33)45(5,6)7;/h12-19,21-28H,1-11H3;/q-1; |
| InChIKey | HVIIPWDYWKOLMR-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.16 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|