C40H38F3IrN4- — CID 140826760
CID 140826760 (PubChem CID 140826760) has the molecular formula C40H38F3IrN4- and a molecular weight of 823.98 g/mol.
| Compound Name | CID 140826760 |
|---|---|
| PubChem CID | 140826760 |
| Molecular Formula | C40H38F3IrN4- |
| Molecular Weight | 823.98 g/mol |
| Exact Mass | 824.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cnc(-c4[c-]cc5c(c4)C4CCC5C4)cc3C(F)(F)F)n2)cc1.[Ir] |
| InChI | InChI=1S/C40H38F3N4.Ir/c1-38(2,3)28-14-9-23(10-15-28)35-45-36(24-11-16-29(17-12-24)39(4,5)6)47-37(46-35)32-22-44-34(21-33(32)40(41,42)43)27-13-18-30-25-7-8-26(19-25)31(30)20-27;/h9-12,14-18,20-22,25-26H,7-8,19H2,1-6H3;/q-1; |
| InChIKey | ALJNODJVKPQCGY-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.98 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|