C25H39FO2Si2 — CID 140827398
[(2S,3S,4S)-4-benzyl-3-[(4-fluorophenyl)methyl]-5-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane (PubChem CID 140827398) has the molecular formula C25H39FO2Si2 and a molecular weight of 446.76 g/mol. Its IUPAC name is [(2S,3S,4S)-4-benzyl-3-[(4-fluorophenyl)methyl]-5-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4S)-4-benzyl-3-[(4-fluorophenyl)methyl]-5-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 140827398 |
| Molecular Formula | C25H39FO2Si2 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(2S,3S,4S)-4-benzyl-3-[(4-fluorophenyl)methyl]-5-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane |
| SMILES | C[C@H](O[Si](C)(C)C)[C@@H](Cc1ccc(F)cc1)[C@@H](CO[Si](C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C25H39FO2Si2/c1-20(28-30(5,6)7)25(18-22-13-15-24(26)16-14-22)23(19-27-29(2,3)4)17-21-11-9-8-10-12-21/h8-16,20,23,25H,17-19H2,1-7H3/t20-,23+,25+/m0/s1 |
| InChIKey | BAAXHWDWRSCUDF-QUURXOELSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|