C16H12F2I3O7S- — CID 140828196
1,1-difluoro-2-[4-(2,3,5-triiodobenzoyl)oxycyclohex-2-ene-1-carbonyl]oxyethanesulfonate (PubChem CID 140828196) has the molecular formula C16H12F2I3O7S- and a molecular weight of 767.04 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-(2,3,5-triiodobenzoyl)oxycyclohex-2-ene-1-carbonyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[4-(2,3,5-triiodobenzoyl)oxycyclohex-2-ene-1-carbonyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 140828196 |
| Molecular Formula | C16H12F2I3O7S- |
| Molecular Weight | 767.04 g/mol |
| Exact Mass | 766.74 |
| IUPAC Name | 1,1-difluoro-2-[4-(2,3,5-triiodobenzoyl)oxycyclohex-2-ene-1-carbonyl]oxyethanesulfonate |
| SMILES | O=C(OC1C=CC(C(=O)OCC(F)(F)S(=O)(=O)[O-])CC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H13F2I3O7S/c17-16(18,29(24,25)26)7-27-14(22)8-1-3-10(4-2-8)28-15(23)11-5-9(19)6-12(20)13(11)21/h1,3,5-6,8,10H,2,4,7H2,(H,24,25,26)/p-1 |
| InChIKey | OWZDAYLKSMTNLS-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|