C15H6F2I3O7S- — CID 140828235
1,1-difluoro-2-oxo-2-[4-(2,3,5-triiodobenzoyl)oxyphenoxy]ethanesulfonate (PubChem CID 140828235) has the molecular formula C15H6F2I3O7S- and a molecular weight of 748.98 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4-(2,3,5-triiodobenzoyl)oxyphenoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-oxo-2-[4-(2,3,5-triiodobenzoyl)oxyphenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 140828235 |
| Molecular Formula | C15H6F2I3O7S- |
| Molecular Weight | 748.98 g/mol |
| Exact Mass | 748.69 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4-(2,3,5-triiodobenzoyl)oxyphenoxy]ethanesulfonate |
| SMILES | O=C(Oc1ccc(OC(=O)C(F)(F)S(=O)(=O)[O-])cc1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C15H7F2I3O7S/c16-15(17,28(23,24)25)14(22)27-9-3-1-8(2-4-9)26-13(21)10-5-7(18)6-11(19)12(10)20/h1-6H,(H,23,24,25)/p-1 |
| InChIKey | XERCHCGZMZHFJB-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.98 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|