C36H45N3 — CID 140828529
2,4,6-tris[4-(2,2-dimethylpropyl)phenyl]-1,3,5-triazine (PubChem CID 140828529) has the molecular formula C36H45N3 and a molecular weight of 519.78 g/mol. Its IUPAC name is 2,4,6-tris[4-(2,2-dimethylpropyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-(2,2-dimethylpropyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140828529 |
| Molecular Formula | C36H45N3 |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | 2,4,6-tris[4-(2,2-dimethylpropyl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)Cc1ccc(-c2nc(-c3ccc(CC(C)(C)C)cc3)nc(-c3ccc(CC(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C36H45N3/c1-34(2,3)22-25-10-16-28(17-11-25)31-37-32(29-18-12-26(13-19-29)23-35(4,5)6)39-33(38-31)30-20-14-27(15-21-30)24-36(7,8)9/h10-21H,22-24H2,1-9H3 |
| InChIKey | HCNUSWSSEMHYQG-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |