C41H51FN6O2Si — CID 140828930
N-[[8-(benzhydrylideneamino)-3-[(2-ethyl-3-fluorophenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]methyl]-2-[tert-butyl(dimethyl)silyl]oxyethanamine (PubChem CID 140828930) has the molecular formula C41H51FN6O2Si and a molecular weight of 706.98 g/mol. Its IUPAC name is N-[[8-(benzhydrylideneamino)-3-[(2-ethyl-3-fluorophenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]methyl]-2-[tert-butyl(dimethyl)silyl]oxyethanamine.
| Compound Name | N-[[8-(benzhydrylideneamino)-3-[(2-ethyl-3-fluorophenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]methyl]-2-[tert-butyl(dimethyl)silyl]oxyethanamine |
|---|---|
| PubChem CID | 140828930 |
| Molecular Formula | C41H51FN6O2Si |
| Molecular Weight | 706.98 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | N-[[8-(benzhydrylideneamino)-3-[(2-ethyl-3-fluorophenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]methyl]-2-[tert-butyl(dimethyl)silyl]oxyethanamine |
| SMILES | CCc1c(F)cccc1Cc1c(CNCCO[Si](C)(C)C(C)(C)C)nc2c(N=C(c3ccccc3)c3ccccc3)cc(N3CCOCC3)nn12 |
| InChI | InChI=1S/C41H51FN6O2Si/c1-7-33-32(19-14-20-34(33)42)27-37-36(29-43-21-24-50-51(5,6)41(2,3)4)45-40-35(28-38(46-48(37)40)47-22-25-49-26-23-47)44-39(30-15-10-8-11-16-30)31-17-12-9-13-18-31/h8-20,28,43H,7,21-27,29H2,1-6H3 |
| InChIKey | CHDZICUSXYJFSA-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.98 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|