C16H12Cl2N2Si — CID 140829135
2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline (PubChem CID 140829135) has the molecular formula C16H12Cl2N2Si and a molecular weight of 331.28 g/mol. Its IUPAC name is 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline.
| Compound Name | 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline |
|---|---|
| PubChem CID | 140829135 |
| Molecular Formula | C16H12Cl2N2Si |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline |
| SMILES | C[Si]1(C)c2ccccc2-c2c1ccc1c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C16H12Cl2N2Si/c1-21(2)11-6-4-3-5-9(11)13-12(21)8-7-10-14(13)19-16(18)20-15(10)17/h3-8H,1-2H3 |
| InChIKey | XDXJZBAYBAITML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|