About 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline
2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline (PubChem CID 140829135) has the molecular formula C16H12Cl2N2Si
and a molecular weight of 331.28 g/mol. Its IUPAC name is 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline.
Molecular Properties
| Compound Name | 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline |
| PubChem CID | 140829135 |
| Molecular Formula | C16H12Cl2N2Si |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline |
| SMILES | C[Si]1(C)c2ccccc2-c2c1ccc1c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C16H12Cl2N2Si/c1-21(2)11-6-4-3-5-9(11)13-12(21)8-7-10-14(13)19-16(18)20-15(10)17/h3-8H,1-2H3 |
| InChIKey | XDXJZBAYBAITML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline?
The IUPAC name of 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline (CID 140829135) is 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline.
What is the SMILES notation for 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline?
The canonical SMILES for 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline is C[Si]1(C)c2ccccc2-c2c1ccc1c(Cl)nc(Cl)nc21.
What is the InChIKey of 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline?
The InChIKey is XDXJZBAYBAITML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N2Si/c1-21(2)11-6-4-3-5-9(11)13-12(21)8-7-10-14(13)19-16(18)20-15(10)17/h3-8H,1-2H3.
What are the key properties of 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline?
2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline has a molecular weight of 331.28 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7,7-dimethyl-[1]benzosilolo[2,3-h]quinazoline is sourced from PubChem (CID 140829135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).