About 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole
6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 140829383) has the molecular formula C11H7BBrClO2S
and a molecular weight of 329.41 g/mol. Its IUPAC name is 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| PubChem CID | 140829383 |
| Molecular Formula | C11H7BBrClO2S |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2cc(Cl)c(-c3sccc3Br)cc21 |
| InChI | InChI=1S/C11H7BBrClO2S/c13-9-1-2-17-11(9)7-4-8-6(3-10(7)14)5-16-12(8)15/h1-4,15H,5H2 |
| InChIKey | LWASXOFOIJHUAM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole?
The IUPAC name of 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole (CID 140829383) is 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole.
What is the SMILES notation for 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole?
The canonical SMILES for 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole is OB1OCc2cc(Cl)c(-c3sccc3Br)cc21.
What is the InChIKey of 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole?
The InChIKey is LWASXOFOIJHUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BBrClO2S/c13-9-1-2-17-11(9)7-4-8-6(3-10(7)14)5-16-12(8)15/h1-4,15H,5H2.
What are the key properties of 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole?
6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole has a molecular weight of 329.41 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromothiophen-2-yl)-5-chloro-1-hydroxy-3H-2,1-benzoxaborole is sourced from PubChem (CID 140829383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).