C30H47FN2O2Si — CID 140830353
tert-butyl 4-[4-fluoro-3-propan-2-yl-1-tri(propan-2-yl)silylindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 140830353) has the molecular formula C30H47FN2O2Si and a molecular weight of 514.80 g/mol. Its IUPAC name is tert-butyl 4-[4-fluoro-3-propan-2-yl-1-tri(propan-2-yl)silylindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-fluoro-3-propan-2-yl-1-tri(propan-2-yl)silylindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 140830353 |
| Molecular Formula | C30H47FN2O2Si |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | tert-butyl 4-[4-fluoro-3-propan-2-yl-1-tri(propan-2-yl)silylindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)c1cn([Si](C(C)C)(C(C)C)C(C)C)c2ccc(C3=CCN(C(=O)OC(C)(C)C)CC3)c(F)c12 |
| InChI | InChI=1S/C30H47FN2O2Si/c1-19(2)25-18-33(36(20(3)4,21(5)6)22(7)8)26-13-12-24(28(31)27(25)26)23-14-16-32(17-15-23)29(34)35-30(9,10)11/h12-14,18-22H,15-17H2,1-11H3 |
| InChIKey | YMIYJFMYIZQZLG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|