C24H31BO6 — CID 140830422
5-methoxy-2,2-dimethyl-8-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-benzodioxin-4-one (PubChem CID 140830422) has the molecular formula C24H31BO6 and a molecular weight of 426.32 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-8-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-benzodioxin-4-one.
| Compound Name | 5-methoxy-2,2-dimethyl-8-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 140830422 |
| Molecular Formula | C24H31BO6 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-8-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-benzodioxin-4-one |
| SMILES | COc1ccc(C2C3C=CC(C3)C2B2OC(C)(C)C(C)(C)O2)c2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C24H31BO6/c1-22(2)23(3,4)31-25(30-22)19-14-9-8-13(12-14)17(19)15-10-11-16(27-7)18-20(15)28-24(5,6)29-21(18)26/h8-11,13-14,17,19H,12H2,1-7H3 |
| InChIKey | LHDOFPMYFNFNBQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|