C23H29BO5 — CID 140830465
2,2-dimethyl-8-[(1S,2R)-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]cyclopropyl]-1,3-benzodioxin-4-one (PubChem CID 140830465) has the molecular formula C23H29BO5 and a molecular weight of 396.29 g/mol. Its IUPAC name is 2,2-dimethyl-8-[(1S,2R)-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]cyclopropyl]-1,3-benzodioxin-4-one.
| Compound Name | 2,2-dimethyl-8-[(1S,2R)-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]cyclopropyl]-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 140830465 |
| Molecular Formula | C23H29BO5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2,2-dimethyl-8-[(1S,2R)-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]cyclopropyl]-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)c2cccc([C@H]3C[C@H]3B3OC4CC5CC(C5(C)C)[C@]4(C)O3)c2O1 |
| InChI | InChI=1S/C23H29BO5/c1-21(2)12-9-17(21)23(5)18(10-12)28-24(29-23)16-11-15(16)13-7-6-8-14-19(13)26-22(3,4)27-20(14)25/h6-8,12,15-18H,9-11H2,1-5H3/t12?,15-,16-,17?,18?,23+/m1/s1 |
| InChIKey | QJNGIJWHGATDPB-GSLBGUIYSA-N |
| XLogP | 4.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|