About methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate
methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate (PubChem CID 140830629) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate |
| PubChem CID | 140830629 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)c(Cl)c(C)c1C#N |
| InChI | InChI=1S/C10H9ClN2O2/c1-5-7(4-12)9(10(14)15-3)13-6(2)8(5)11/h1-3H3 |
| InChIKey | MHDTVDGEYIDXHK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate?
The IUPAC name of methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate (CID 140830629) is methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate is COC(=O)c1nc(C)c(Cl)c(C)c1C#N.
What is the InChIKey of methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate?
The InChIKey is MHDTVDGEYIDXHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c1-5-7(4-12)9(10(14)15-3)13-6(2)8(5)11/h1-3H3.
What are the key properties of methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate?
methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate has a molecular weight of 224.65 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-3-cyano-4,6-dimethylpyridine-2-carboxylate is sourced from PubChem (CID 140830629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).