C27H26ClN9O5 — CID 14083085
5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoic acid (PubChem CID 14083085) has the molecular formula C27H26ClN9O5 and a molecular weight of 592.02 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoic acid.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 14083085 |
| Molecular Formula | C27H26ClN9O5 |
| Molecular Weight | 592.02 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanoic acid |
| SMILES | Nc1nc(N)c2nc(CN(C=O)c3ccc(C(=O)NC(CCCNC(=O)c4ccc(Cl)cc4)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C27H26ClN9O5/c28-17-7-3-15(4-8-17)24(39)31-11-1-2-20(26(41)42)34-25(40)16-5-9-19(10-6-16)37(14-38)13-18-12-32-23-21(33-18)22(29)35-27(30)36-23/h3-10,12,14,20H,1-2,11,13H2,(H,31,39)(H,34,40)(H,41,42)(H4,29,30,32,35,36) |
| InChIKey | XVKWCKAUCRQXJE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 219.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.02 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|