C26H26ClN9O4 — CID 14083097
5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid (PubChem CID 14083097) has the molecular formula C26H26ClN9O4 and a molecular weight of 564.01 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 14083097 |
| Molecular Formula | C26H26ClN9O4 |
| Molecular Weight | 564.01 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)NC(CCCNC(=O)c4ccc(Cl)cc4)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C26H26ClN9O4/c27-16-7-3-14(4-8-16)23(37)30-11-1-2-19(25(39)40)34-24(38)15-5-9-17(10-6-15)31-12-18-13-32-22-20(33-18)21(28)35-26(29)36-22/h3-10,13,19,31H,1-2,11-12H2,(H,30,37)(H,34,38)(H,39,40)(H4,28,29,32,35,36) |
| InChIKey | XVOYGLABRSZMKM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 211.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|