C30H43N3O4SSi — CID 140831135
N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(1-phenylethyl)-N-(2-trimethylsilylethoxymethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 140831135) has the molecular formula C30H43N3O4SSi and a molecular weight of 569.84 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(1-phenylethyl)-N-(2-trimethylsilylethoxymethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(1-phenylethyl)-N-(2-trimethylsilylethoxymethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 140831135 |
| Molecular Formula | C30H43N3O4SSi |
| Molecular Weight | 569.84 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(1-phenylethyl)-N-(2-trimethylsilylethoxymethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CC(c1ccccc1)N1CCc2ccc(S(=O)(=O)N(COCC[Si](C)(C)C)c3cc(C(C)(C)C)on3)cc2C1 |
| InChI | InChI=1S/C30H43N3O4SSi/c1-23(24-11-9-8-10-12-24)32-16-15-25-13-14-27(19-26(25)21-32)38(34,35)33(22-36-17-18-39(5,6)7)29-20-28(37-31-29)30(2,3)4/h8-14,19-20,23H,15-18,21-22H2,1-7H3 |
| InChIKey | REARETRLLIGGGP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.84 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|