C21H20BClF2O3 — CID 140831149
2-chloro-1-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]ethanone (PubChem CID 140831149) has the molecular formula C21H20BClF2O3 and a molecular weight of 404.65 g/mol. Its IUPAC name is 2-chloro-1-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]ethanone.
| Compound Name | 2-chloro-1-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]ethanone |
|---|---|
| PubChem CID | 140831149 |
| Molecular Formula | C21H20BClF2O3 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-chloro-1-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]ethanone |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(F)(F)c2cc(C(=O)CCl)ccc2-3)OC1(C)C |
| InChI | InChI=1S/C21H20BClF2O3/c1-19(2)20(3,4)28-22(27-19)13-6-8-15-14-7-5-12(18(26)11-23)9-16(14)21(24,25)17(15)10-13/h5-10H,11H2,1-4H3 |
| InChIKey | UMGRLAHGQJILAT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|