C23H20F3N5O4 — CID 140831190
4-[[3-isocyano-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methoxy]-1-methyl-6-morpholin-4-ylpyrimidin-2-one (PubChem CID 140831190) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is 4-[[3-isocyano-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methoxy]-1-methyl-6-morpholin-4-ylpyrimidin-2-one.
| Compound Name | 4-[[3-isocyano-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methoxy]-1-methyl-6-morpholin-4-ylpyrimidin-2-one |
|---|---|
| PubChem CID | 140831190 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[[3-isocyano-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methoxy]-1-methyl-6-morpholin-4-ylpyrimidin-2-one |
| SMILES | [C-]#[N+]c1cc(COc2cc(N3CCOCC3)n(C)c(=O)n2)ccc1Oc1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N5O4/c1-27-18-9-15(3-4-19(18)35-17-10-16(12-28-13-17)23(24,25)26)14-34-20-11-21(30(2)22(32)29-20)31-5-7-33-8-6-31/h3-4,9-13H,5-8,14H2,2H3 |
| InChIKey | ZAFGMRDBQQPLPX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|