About 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride
2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride (PubChem CID 140831216) has the molecular formula C9H23BClN3O6S
and a molecular weight of 347.63 g/mol. Its IUPAC name is 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride |
| PubChem CID | 140831216 |
| Molecular Formula | C9H23BClN3O6S |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride |
| SMILES | CN(C)S(=O)(=O)NCC(N)(CCCCB(O)O)C(=O)O.Cl |
| InChI | InChI=1S/C9H22BN3O6S.ClH/c1-13(2)20(18,19)12-7-9(11,8(14)15)5-3-4-6-10(16)17;/h12,16-17H,3-7,11H2,1-2H3,(H,14,15);1H |
| InChIKey | LUASEAHRCZEDGB-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride?
The IUPAC name of 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride (CID 140831216) is 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride.
What is the SMILES notation for 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride?
The canonical SMILES for 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride is CN(C)S(=O)(=O)NCC(N)(CCCCB(O)O)C(=O)O.Cl.
What is the InChIKey of 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride?
The InChIKey is LUASEAHRCZEDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22BN3O6S.ClH/c1-13(2)20(18,19)12-7-9(11,8(14)15)5-3-4-6-10(16)17;/h12,16-17H,3-7,11H2,1-2H3,(H,14,15);1H.
What are the key properties of 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride?
2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride has a molecular weight of 347.63 g/mol, XLogP of -1.77, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-borono-2-[(dimethylsulfamoylamino)methyl]hexanoic acid;hydrochloride is sourced from PubChem (CID 140831216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).