C33H28N3OPtSi- — CID 140831945
2-[1-phenyl-4-[3-(5-trimethylsilyl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 140831945) has the molecular formula C33H28N3OPtSi- and a molecular weight of 705.77 g/mol. Its IUPAC name is 2-[1-phenyl-4-[3-(5-trimethylsilyl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-phenyl-4-[3-(5-trimethylsilyl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140831945 |
| Molecular Formula | C33H28N3OPtSi- |
| Molecular Weight | 705.77 g/mol |
| Exact Mass | 705.17 |
| IUPAC Name | 2-[1-phenyl-4-[3-(5-trimethylsilyl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]c(-c3cccc4c3nc(-c3ccccc3O)n4-c3ccccc3)ccc2)nc1.[Pt] |
| InChI | InChI=1S/C33H28N3OSi.Pt/c1-38(2,3)26-19-20-29(34-22-26)24-12-9-11-23(21-24)27-16-10-17-30-32(27)35-33(28-15-7-8-18-31(28)37)36(30)25-13-5-4-6-14-25;/h4-20,22,37H,1-3H3;/q-1; |
| InChIKey | UVPBOCAYJUUANA-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.77 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|