C51H48N3OPt- — CID 140832103
2,4-ditert-butyl-6-[1-naphthalen-1-yl-4-[3-(5-phenyl-2-pyridinyl)-5-propan-2-ylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 140832103) has the molecular formula C51H48N3OPt- and a molecular weight of 914.04 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-naphthalen-1-yl-4-[3-(5-phenyl-2-pyridinyl)-5-propan-2-ylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-naphthalen-1-yl-4-[3-(5-phenyl-2-pyridinyl)-5-propan-2-ylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140832103 |
| Molecular Formula | C51H48N3OPt- |
| Molecular Weight | 914.04 g/mol |
| Exact Mass | 913.35 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-naphthalen-1-yl-4-[3-(5-phenyl-2-pyridinyl)-5-propan-2-ylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)c1cc(-c2ccc(-c3ccccc3)cn2)[c-]c(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3-c2cccc3ccccc23)c1.[Pt] |
| InChI | InChI=1S/C51H48N3O.Pt/c1-32(2)36-26-37(28-38(27-36)44-25-24-35(31-52-44)33-16-10-9-11-17-33)41-21-15-23-46-47(41)53-49(54(46)45-22-14-19-34-18-12-13-20-40(34)45)42-29-39(50(3,4)5)30-43(48(42)55)51(6,7)8;/h9-27,29-32,55H,1-8H3;/q-1; |
| InChIKey | FGWYFIFOKYIRMV-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.04 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|