C46H44N3OPt- — CID 140832375
2,4-ditert-butyl-6-[1-methyl-4-[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 140832375) has the molecular formula C46H44N3OPt- and a molecular weight of 849.96 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-methyl-4-[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140832375 |
| Molecular Formula | C46H44N3OPt- |
| Molecular Weight | 849.96 g/mol |
| Exact Mass | 849.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | Cc1cnc(-c2[c-]c(-c3cccc4c3nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)n4C)cc(-c3ccccc3)c2)cc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C46H44N3O.Pt/c1-29-28-47-40(27-37(29)31-18-13-10-14-19-31)34-23-32(30-16-11-9-12-17-30)22-33(24-34)36-20-15-21-41-42(36)48-44(49(41)8)38-25-35(45(2,3)4)26-39(43(38)50)46(5,6)7;/h9-23,25-28,50H,1-8H3;/q-1; |
| InChIKey | PAOAUVDEBGNSTR-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.96 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|