C8H15BF2N2 — CID 140833394
[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl-difluoroborane (PubChem CID 140833394) has the molecular formula C8H15BF2N2 and a molecular weight of 188.03 g/mol. Its IUPAC name is [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl-difluoroborane.
| Compound Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl-difluoroborane |
|---|---|
| PubChem CID | 140833394 |
| Molecular Formula | C8H15BF2N2 |
| Molecular Weight | 188.03 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl-difluoroborane |
| SMILES | FB(F)CN1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C8H15BF2N2/c10-9(11)7-12-4-5-13-3-1-2-8(13)6-12/h8H,1-7H2/t8-/m1/s1 |
| InChIKey | CJLWHIOLLYRZEM-MRVPVSSYSA-N |
| XLogP | 0.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.03 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|