C60H65B2N — CID 140835311
9-[4-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]carbazole (PubChem CID 140835311) has the molecular formula C60H65B2N and a molecular weight of 821.81 g/mol. Its IUPAC name is 9-[4-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]carbazole.
| Compound Name | 9-[4-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 140835311 |
| Molecular Formula | C60H65B2N |
| Molecular Weight | 821.81 g/mol |
| Exact Mass | 821.53 |
| IUPAC Name | 9-[4-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]carbazole |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccccc3B(c3c(C(C)C)cc(C(C)C)cc3C(C)C)c3cc(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C60H65B2N/c1-36(2)44-31-49(38(5)6)59(50(32-44)39(7)8)61-53-21-15-16-22-54(53)62(60-51(40(9)10)33-45(37(3)4)34-52(60)41(11)12)56-35-43(27-30-55(56)61)42-25-28-46(29-26-42)63-57-23-17-13-19-47(57)48-20-14-18-24-58(48)63/h13-41H,1-12H3 |
| InChIKey | MQQIVOTXAAUESO-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.81 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|