C53H52BNOSi — CID 140835322
2,8-dimethyl-10,10-diphenyl-5-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]benzo[b][1,4]benzazasiline (PubChem CID 140835322) has the molecular formula C53H52BNOSi and a molecular weight of 757.90 g/mol. Its IUPAC name is 2,8-dimethyl-10,10-diphenyl-5-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]benzo[b][1,4]benzazasiline.
| Compound Name | 2,8-dimethyl-10,10-diphenyl-5-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]benzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 140835322 |
| Molecular Formula | C53H52BNOSi |
| Molecular Weight | 757.90 g/mol |
| Exact Mass | 757.39 |
| IUPAC Name | 2,8-dimethyl-10,10-diphenyl-5-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]benzo[b][1,4]benzazasiline |
| SMILES | Cc1ccc2c(c1)[Si](c1ccccc1)(c1ccccc1)c1cc(C)ccc1N2c1ccc2c(c1)Oc1ccccc1B2c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C53H52BNOSi/c1-34(2)39-31-43(35(3)4)53(44(32-39)36(5)6)54-45-21-15-16-22-49(45)56-50-33-40(25-26-46(50)54)55-47-27-23-37(7)29-51(47)57(41-17-11-9-12-18-41,42-19-13-10-14-20-42)52-30-38(8)24-28-48(52)55/h9-36H,1-8H3 |
| InChIKey | PJMPEDGNTBXXSY-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.90 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|