C15H22 — CID 14083575
4,7-dimethyl-1-propan-2-yl-1,2,6,8a-tetrahydronaphthalene (PubChem CID 14083575) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 4,7-dimethyl-1-propan-2-yl-1,2,6,8a-tetrahydronaphthalene.
| Compound Name | 4,7-dimethyl-1-propan-2-yl-1,2,6,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 14083575 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4,7-dimethyl-1-propan-2-yl-1,2,6,8a-tetrahydronaphthalene |
| SMILES | CC1=CC2C(=CC1)C(C)=CCC2C(C)C |
| InChI | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6-7,9-10,13,15H,5,8H2,1-4H3 |
| InChIKey | KGEVYKNFJQYULL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|