C20H26FN4O4P — CID 140836367
(3S)-3-(4-aminobutyl)-1-[(4-fluoro-2-pyrimidin-5-ylphenyl)methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 140836367) has the molecular formula C20H26FN4O4P and a molecular weight of 436.42 g/mol. Its IUPAC name is (3S)-3-(4-aminobutyl)-1-[(4-fluoro-2-pyrimidin-5-ylphenyl)methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | (3S)-3-(4-aminobutyl)-1-[(4-fluoro-2-pyrimidin-5-ylphenyl)methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 140836367 |
| Molecular Formula | C20H26FN4O4P |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (3S)-3-(4-aminobutyl)-1-[(4-fluoro-2-pyrimidin-5-ylphenyl)methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | NCCCC[C@@]1(C(=O)O)CN(Cc2ccc(F)cc2-c2cncnc2)CCP1(=O)O |
| InChI | InChI=1S/C20H26FN4O4P/c21-17-4-3-15(18(9-17)16-10-23-14-24-11-16)12-25-7-8-30(28,29)20(13-25,19(26)27)5-1-2-6-22/h3-4,9-11,14H,1-2,5-8,12-13,22H2,(H,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | OMPACBMICGZNQY-FQEVSTJZSA-N |
| XLogP | 2.32 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|