C38H56FN2O8P — CID 140836379
tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[2-(4-fluorophenyl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate (PubChem CID 140836379) has the molecular formula C38H56FN2O8P and a molecular weight of 718.84 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[2-(4-fluorophenyl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[2-(4-fluorophenyl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
|---|---|
| PubChem CID | 140836379 |
| Molecular Formula | C38H56FN2O8P |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[2-(4-fluorophenyl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
| SMILES | CCOP1(=O)CCN(Cc2ccccc2-c2ccc(F)cc2)C[C@@]1(CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H56FN2O8P/c1-11-46-50(45)25-24-40(26-29-16-12-13-17-31(29)28-18-20-30(39)21-19-28)27-38(50,32(42)47-35(2,3)4)22-14-15-23-41(33(43)48-36(5,6)7)34(44)49-37(8,9)10/h12-13,16-21H,11,14-15,22-27H2,1-10H3/t38-,50?/m0/s1 |
| InChIKey | LIOPNVUDVVATCT-DXYIDXTDSA-N |
| XLogP | 9.05 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|