C35H56N3O10P — CID 140836446
tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-1,4λ5-azaphosphinane-3-carboxylate (PubChem CID 140836446) has the molecular formula C35H56N3O10P and a molecular weight of 709.82 g/mol. Its IUPAC name is tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-1,4λ5-azaphosphinane-3-carboxylate.
| Compound Name | tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-1,4λ5-azaphosphinane-3-carboxylate |
|---|---|
| PubChem CID | 140836446 |
| Molecular Formula | C35H56N3O10P |
| Molecular Weight | 709.82 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-1,4λ5-azaphosphinane-3-carboxylate |
| SMILES | CCOP1(=O)CCN(Cc2ccccc2N2CCOC2=O)CC1(CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H56N3O10P/c1-11-45-49(43)23-21-36(24-26-16-12-13-17-27(26)37-20-22-44-29(37)40)25-35(49,28(39)46-32(2,3)4)18-14-15-19-38(30(41)47-33(5,6)7)31(42)48-34(8,9)10/h12-13,16-17H,11,14-15,18-25H2,1-10H3 |
| InChIKey | KNXXOACWCUVDBP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 141.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.82 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|