C36H56FN4O8P — CID 140836487
tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate (PubChem CID 140836487) has the molecular formula C36H56FN4O8P and a molecular weight of 722.84 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
|---|---|
| PubChem CID | 140836487 |
| Molecular Formula | C36H56FN4O8P |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.38 |
| IUPAC Name | tert-butyl (3S)-3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[[4-fluoro-2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
| SMILES | CCOP1(=O)CCN(Cc2ccc(F)cc2-c2cncn2C)C[C@@]1(CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H56FN4O8P/c1-12-46-50(45)20-19-40(23-26-15-16-27(37)21-28(26)29-22-38-25-39(29)11)24-36(50,30(42)47-33(2,3)4)17-13-14-18-41(31(43)48-34(5,6)7)32(44)49-35(8,9)10/h15-16,21-22,25H,12-14,17-20,23-24H2,1-11H3/t36-,50?/m0/s1 |
| InChIKey | QMBHNMGOYKJTQG-MXXLMVFUSA-N |
| XLogP | 7.78 |
| TPSA | 129.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|