C28H28ClFN6O2 — CID 140837027
1-[3-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-chloro-4-pyridinyl]-3-methoxyurea (PubChem CID 140837027) has the molecular formula C28H28ClFN6O2 and a molecular weight of 535.02 g/mol. Its IUPAC name is 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-chloro-4-pyridinyl]-3-methoxyurea.
| Compound Name | 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-chloro-4-pyridinyl]-3-methoxyurea |
|---|---|
| PubChem CID | 140837027 |
| Molecular Formula | C28H28ClFN6O2 |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-chloro-4-pyridinyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1c(Cl)cncc1-c1ccc2ncc(-c3cc(C)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C28H28ClFN6O2/c1-16-9-18(11-19(30)10-16)23-14-33-25-4-3-17(12-21(25)27(23)36-7-5-20(31)6-8-36)22-13-32-15-24(29)26(22)34-28(37)35-38-2/h3-4,9-15,20H,5-8,31H2,1-2H3,(H2,32,34,35,37) |
| InChIKey | CLGPMUVHORFLFO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|