About 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine
1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine (PubChem CID 140837078) has the molecular formula C21H22Cl2N4
and a molecular weight of 401.34 g/mol. Its IUPAC name is 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine |
| PubChem CID | 140837078 |
| Molecular Formula | C21H22Cl2N4 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine |
| SMILES | Cc1cc(C)cc(-c2nnc3cc(Cl)c(Cl)cc3c2N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C21H22Cl2N4/c1-12-7-13(2)9-14(8-12)20-21(27-5-3-15(24)4-6-27)16-10-17(22)18(23)11-19(16)25-26-20/h7-11,15H,3-6,24H2,1-2H3 |
| InChIKey | PRNAMSJSZFEMNF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine?
The IUPAC name of 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine (CID 140837078) is 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine.
What is the SMILES notation for 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine?
The canonical SMILES for 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine is Cc1cc(C)cc(-c2nnc3cc(Cl)c(Cl)cc3c2N2CCC(N)CC2)c1.
What is the InChIKey of 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine?
The InChIKey is PRNAMSJSZFEMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Cl2N4/c1-12-7-13(2)9-14(8-12)20-21(27-5-3-15(24)4-6-27)16-10-17(22)18(23)11-19(16)25-26-20/h7-11,15H,3-6,24H2,1-2H3.
What are the key properties of 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine?
1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine has a molecular weight of 401.34 g/mol, XLogP of 5.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6,7-dichloro-3-(3,5-dimethylphenyl)cinnolin-4-yl]piperidin-4-amine is sourced from PubChem (CID 140837078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).