C28H23F5N4O2 — CID 140837105
methyl N-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-3,4,6-trifluorophenyl]carbamate (PubChem CID 140837105) has the molecular formula C28H23F5N4O2 and a molecular weight of 542.51 g/mol. Its IUPAC name is methyl N-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-3,4,6-trifluorophenyl]carbamate.
| Compound Name | methyl N-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-3,4,6-trifluorophenyl]carbamate |
|---|---|
| PubChem CID | 140837105 |
| Molecular Formula | C28H23F5N4O2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | methyl N-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-3,4,6-trifluorophenyl]carbamate |
| SMILES | COC(=O)Nc1c(F)cc(F)c(F)c1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C28H23F5N4O2/c1-39-28(38)36-26-22(32)12-21(31)25(33)24(26)14-2-3-23-19(10-14)27(37-6-4-18(34)5-7-37)20(13-35-23)15-8-16(29)11-17(30)9-15/h2-3,8-13,18H,4-7,34H2,1H3,(H,36,38) |
| InChIKey | IUDYSTFYPJMLBC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|