C15H18F3N3S — CID 140837862
3-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]-1,2-benzothiazol-6-amine (PubChem CID 140837862) has the molecular formula C15H18F3N3S and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]-1,2-benzothiazol-6-amine.
| Compound Name | 3-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]-1,2-benzothiazol-6-amine |
|---|---|
| PubChem CID | 140837862 |
| Molecular Formula | C15H18F3N3S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]-1,2-benzothiazol-6-amine |
| SMILES | Nc1ccc2c(C3CCN(CCC(F)(F)F)CC3)nsc2c1 |
| InChI | InChI=1S/C15H18F3N3S/c16-15(17,18)5-8-21-6-3-10(4-7-21)14-12-2-1-11(19)9-13(12)22-20-14/h1-2,9-10H,3-8,19H2 |
| InChIKey | XBJCRSPAYZVAPF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|