C12H17ClN4O2 — CID 140838007
2-chloro-4-deuterio-6-[1,2,2,3,3,4,5,6,6-nonadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]imino-1H-pyrimidine-5-carboxamide (PubChem CID 140838007) has the molecular formula C12H17ClN4O2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-chloro-4-deuterio-6-[1,2,2,3,3,4,5,6,6-nonadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]imino-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-chloro-4-deuterio-6-[1,2,2,3,3,4,5,6,6-nonadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]imino-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 140838007 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-chloro-4-deuterio-6-[1,2,2,3,3,4,5,6,6-nonadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]imino-1H-pyrimidine-5-carboxamide |
| SMILES | [2H]c1nc(Cl)[nH]/c(=N\C2([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(O)C2([2H])[2H])c1C(N)=O |
| InChI | InChI=1S/C12H17ClN4O2/c1-6-2-3-7(4-9(6)18)16-11-8(10(14)19)5-15-12(13)17-11/h5-7,9,18H,2-4H2,1H3,(H2,14,19)(H,15,16,17)/i1D3,2D2,3D2,4D2,5D,6D,7D,9D |
| InChIKey | ULQHZXRYTWQLSD-DVGKCBEJSA-N |
| XLogP | 0.61 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |