C16H27N5O2 — CID 140838113
2-(tert-butylamino)-4-[[1,3,3,4,5-pentadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]amino]pyrimidine-5-carboxamide (PubChem CID 140838113) has the molecular formula C16H27N5O2 and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-(tert-butylamino)-4-[[1,3,3,4,5-pentadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]amino]pyrimidine-5-carboxamide.
| Compound Name | 2-(tert-butylamino)-4-[[1,3,3,4,5-pentadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 140838113 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 2-(tert-butylamino)-4-[[1,3,3,4,5-pentadeuterio-5-hydroxy-4-(trideuteriomethyl)cyclohexyl]amino]pyrimidine-5-carboxamide |
| SMILES | [2H]C1(Nc2nc(NC(C)(C)C)ncc2C(N)=O)CC([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(O)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-9-5-6-10(7-12(9)22)19-14-11(13(17)23)8-18-15(20-14)21-16(2,3)4/h8-10,12,22H,5-7H2,1-4H3,(H2,17,23)(H2,18,19,20,21)/i1D3,5D2,9D,10D,12D |
| InChIKey | QBBRJRLJWXRSHQ-NOKXVBPWSA-N |
| XLogP | 1.75 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |