C24H35FN4OSi — CID 140838240
2-[[5-[4-(3-fluoropropyl)piperidin-1-yl]-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140838240) has the molecular formula C24H35FN4OSi and a molecular weight of 442.66 g/mol. Its IUPAC name is 2-[[5-[4-(3-fluoropropyl)piperidin-1-yl]-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[4-(3-fluoropropyl)piperidin-1-yl]-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140838240 |
| Molecular Formula | C24H35FN4OSi |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[[5-[4-(3-fluoropropyl)piperidin-1-yl]-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2ncccc2c2ccc(N3CCC(CCCF)CC3)nc21 |
| InChI | InChI=1S/C24H35FN4OSi/c1-31(2,3)17-16-30-18-29-23-20(7-5-13-26-23)21-8-9-22(27-24(21)29)28-14-10-19(11-15-28)6-4-12-25/h5,7-9,13,19H,4,6,10-12,14-18H2,1-3H3 |
| InChIKey | BUTHLGCDLPZJJK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|